C10H19N3 — CID 118548920
1-(2,3,3a,4,7,7a-hexahydro-1H-indol-4-ylmethyl)-1-methylhydrazine (PubChem CID 118548920) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-(2,3,3a,4,7,7a-hexahydro-1H-indol-4-ylmethyl)-1-methylhydrazine.
| Compound Name | 1-(2,3,3a,4,7,7a-hexahydro-1H-indol-4-ylmethyl)-1-methylhydrazine |
|---|---|
| PubChem CID | 118548920 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 1-(2,3,3a,4,7,7a-hexahydro-1H-indol-4-ylmethyl)-1-methylhydrazine |
| SMILES | CN(N)CC1C=CCC2NCCC12 |
| InChI | InChI=1S/C10H19N3/c1-13(11)7-8-3-2-4-10-9(8)5-6-12-10/h2-3,8-10,12H,4-7,11H2,1H3 |
| InChIKey | KUEBFZVFTSUXLZ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|