C10H17N3 — CID 118549022
2-(3a,4,7,7a-tetrahydro-1H-indol-4-yl)ethylhydrazine (PubChem CID 118549022) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 2-(3a,4,7,7a-tetrahydro-1H-indol-4-yl)ethylhydrazine.
| Compound Name | 2-(3a,4,7,7a-tetrahydro-1H-indol-4-yl)ethylhydrazine |
|---|---|
| PubChem CID | 118549022 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 2-(3a,4,7,7a-tetrahydro-1H-indol-4-yl)ethylhydrazine |
| SMILES | NNCCC1C=CCC2NC=CC12 |
| InChI | InChI=1S/C10H17N3/c11-13-7-4-8-2-1-3-10-9(8)5-6-12-10/h1-2,5-6,8-10,12-13H,3-4,7,11H2 |
| InChIKey | CXDUHRSXNFDZSX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|