C14H20N2O — CID 118549050
6-(5-methyl-1,2,3,6-tetrahydropyridin-3-yl)-3,4,6,7-tetrahydro-2H-1,4-benzoxazine (PubChem CID 118549050) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 6-(5-methyl-1,2,3,6-tetrahydropyridin-3-yl)-3,4,6,7-tetrahydro-2H-1,4-benzoxazine.
| Compound Name | 6-(5-methyl-1,2,3,6-tetrahydropyridin-3-yl)-3,4,6,7-tetrahydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 118549050 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 6-(5-methyl-1,2,3,6-tetrahydropyridin-3-yl)-3,4,6,7-tetrahydro-2H-1,4-benzoxazine |
| SMILES | CC1=CC(C2C=C3NCCOC3=CC2)CNC1 |
| InChI | InChI=1S/C14H20N2O/c1-10-6-12(9-15-8-10)11-2-3-14-13(7-11)16-4-5-17-14/h3,6-7,11-12,15-16H,2,4-5,8-9H2,1H3 |
| InChIKey | IGGQYYJAVIGFNK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|