C10H15NS — CID 118549058
3-(2,3-dihydrothiophen-3-yl)-5-methyl-1,2,3,6-tetrahydropyridine (PubChem CID 118549058) has the molecular formula C10H15NS and a molecular weight of 181.30 g/mol. Its IUPAC name is 3-(2,3-dihydrothiophen-3-yl)-5-methyl-1,2,3,6-tetrahydropyridine.
| Compound Name | 3-(2,3-dihydrothiophen-3-yl)-5-methyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 118549058 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 3-(2,3-dihydrothiophen-3-yl)-5-methyl-1,2,3,6-tetrahydropyridine |
| SMILES | CC1=CC(C2C=CSC2)CNC1 |
| InChI | InChI=1S/C10H15NS/c1-8-4-10(6-11-5-8)9-2-3-12-7-9/h2-4,9-11H,5-7H2,1H3 |
| InChIKey | AYDBAIPURYOGGX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|