C40H68FNO10 — CID 118549098
[(2S,5S)-2-[(3S,6S)-5-anilino-4-butoxy-2-(butoxymethyl)-6-fluorooxan-3-yl]oxy-4,5-dibutoxy-6-(butoxymethyl)oxan-3-yl] acetate (PubChem CID 118549098) has the molecular formula C40H68FNO10 and a molecular weight of 741.98 g/mol. Its IUPAC name is [(2S,5S)-2-[(3S,6S)-5-anilino-4-butoxy-2-(butoxymethyl)-6-fluorooxan-3-yl]oxy-4,5-dibutoxy-6-(butoxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2S,5S)-2-[(3S,6S)-5-anilino-4-butoxy-2-(butoxymethyl)-6-fluorooxan-3-yl]oxy-4,5-dibutoxy-6-(butoxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 118549098 |
| Molecular Formula | C40H68FNO10 |
| Molecular Weight | 741.98 g/mol |
| Exact Mass | 741.48 |
| IUPAC Name | [(2S,5S)-2-[(3S,6S)-5-anilino-4-butoxy-2-(butoxymethyl)-6-fluorooxan-3-yl]oxy-4,5-dibutoxy-6-(butoxymethyl)oxan-3-yl] acetate |
| SMILES | CCCCOCC1O[C@@H](F)C(Nc2ccccc2)C(OCCCC)[C@@H]1O[C@@H]1OC(COCCCC)[C@H](OCCCC)C(OCCCC)C1OC(C)=O |
| InChI | InChI=1S/C40H68FNO10/c1-7-12-22-44-27-31-34(46-24-14-9-3)37(48-26-16-11-5)38(49-29(6)43)40(51-31)52-35-32(28-45-23-13-8-2)50-39(41)33(36(35)47-25-15-10-4)42-30-20-18-17-19-21-30/h17-21,31-40,42H,7-16,22-28H2,1-6H3/t31?,32?,33?,34-,35+,36?,37?,38?,39+,40-/m0/s1 |
| InChIKey | PSODEURTZOMNOA-LTXBPCSQSA-N |
| XLogP | 7.39 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.98 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|