C11H19FN2O3 — CID 118549134
methyl N-[(2S)-1-[(3S)-3-fluoropyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 118549134) has the molecular formula C11H19FN2O3 and a molecular weight of 246.28 g/mol. Its IUPAC name is methyl N-[(2S)-1-[(3S)-3-fluoropyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[(3S)-3-fluoropyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 118549134 |
| Molecular Formula | C11H19FN2O3 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | methyl N-[(2S)-1-[(3S)-3-fluoropyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CC[C@H](F)C1)C(C)C |
| InChI | InChI=1S/C11H19FN2O3/c1-7(2)9(13-11(16)17-3)10(15)14-5-4-8(12)6-14/h7-9H,4-6H2,1-3H3,(H,13,16)/t8-,9-/m0/s1 |
| InChIKey | GFAOTJHJSWREFA-IUCAKERBSA-N |
| XLogP | 0.94 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |