C28H48O4 — CID 118549200
(6R)-6-[(3R,5S,6R,7R,10S,17R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid (PubChem CID 118549200) has the molecular formula C28H48O4 and a molecular weight of 448.69 g/mol. Its IUPAC name is (6R)-6-[(3R,5S,6R,7R,10S,17R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid.
| Compound Name | (6R)-6-[(3R,5S,6R,7R,10S,17R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid |
|---|---|
| PubChem CID | 118549200 |
| Molecular Formula | C28H48O4 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.36 |
| IUPAC Name | (6R)-6-[(3R,5S,6R,7R,10S,17R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid |
| SMILES | CC[C@H]1C(O)C2C3CC[C@H]([C@H](C)CCCCC(=O)O)C3(C)CCC2[C@@]2(C)CC[C@@H](O)C[C@@H]12 |
| InChI | InChI=1S/C28H48O4/c1-5-19-23-16-18(29)12-14-28(23,4)22-13-15-27(3)20(10-11-21(27)25(22)26(19)32)17(2)8-6-7-9-24(30)31/h17-23,25-26,29,32H,5-16H2,1-4H3,(H,30,31)/t17-,18-,19-,20-,21?,22?,23+,25?,26?,27?,28-/m1/s1 |
| InChIKey | FTTANELGAKJUNV-FCEHUWEWSA-N |
| XLogP | 5.89 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|