About 5-ethyloxadiazolo[5,4-b]pyridine
5-ethyloxadiazolo[5,4-b]pyridine (PubChem CID 118549902) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 5-ethyloxadiazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 5-ethyloxadiazolo[5,4-b]pyridine |
| PubChem CID | 118549902 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 5-ethyloxadiazolo[5,4-b]pyridine |
| SMILES | CCc1ccc2nnoc2n1 |
| InChI | InChI=1S/C7H7N3O/c1-2-5-3-4-6-7(8-5)11-10-9-6/h3-4H,2H2,1H3 |
| InChIKey | MTCDMWKYUZCTFB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethyloxadiazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyloxadiazolo[5,4-b]pyridine?
The IUPAC name of 5-ethyloxadiazolo[5,4-b]pyridine (CID 118549902) is 5-ethyloxadiazolo[5,4-b]pyridine.
What is the SMILES notation for 5-ethyloxadiazolo[5,4-b]pyridine?
The canonical SMILES for 5-ethyloxadiazolo[5,4-b]pyridine is CCc1ccc2nnoc2n1.
What is the InChIKey of 5-ethyloxadiazolo[5,4-b]pyridine?
The InChIKey is MTCDMWKYUZCTFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c1-2-5-3-4-6-7(8-5)11-10-9-6/h3-4H,2H2,1H3.
What are the key properties of 5-ethyloxadiazolo[5,4-b]pyridine?
5-ethyloxadiazolo[5,4-b]pyridine has a molecular weight of 149.15 g/mol, XLogP of 1.18, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyloxadiazolo[5,4-b]pyridine is sourced from PubChem (CID 118549902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).