C6HCl5 — CID 11855
1,2,3,4,5-pentachlorobenzene (PubChem CID 11855) has the molecular formula C6HCl5 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1,2,3,4,5-pentachlorobenzene.
| Compound Name | 1,2,3,4,5-pentachlorobenzene |
|---|---|
| PubChem CID | 11855 |
| Molecular Formula | C6HCl5 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 247.85 |
| IUPAC Name | 1,2,3,4,5-pentachlorobenzene |
| SMILES | Clc1cc(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6HCl5/c7-2-1-3(8)5(10)6(11)4(2)9/h1H |
| InChIKey | CEOCDNVZRAIOQZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|