C21H39NO8 — CID 118550439
(2S,3S)-2-hydroxy-N-[(S)-[(2S,4R,6R)-4-hydroxy-6-[(2S)-2-hydroxy-3-methoxypropyl]-5,5-dimethyloxan-2-yl]-methoxymethyl]-3-methoxy-5-methylhex-5-enamide (PubChem CID 118550439) has the molecular formula C21H39NO8 and a molecular weight of 433.54 g/mol. Its IUPAC name is (2S,3S)-2-hydroxy-N-[(S)-[(2S,4R,6R)-4-hydroxy-6-[(2S)-2-hydroxy-3-methoxypropyl]-5,5-dimethyloxan-2-yl]-methoxymethyl]-3-methoxy-5-methylhex-5-enamide.
| Compound Name | (2S,3S)-2-hydroxy-N-[(S)-[(2S,4R,6R)-4-hydroxy-6-[(2S)-2-hydroxy-3-methoxypropyl]-5,5-dimethyloxan-2-yl]-methoxymethyl]-3-methoxy-5-methylhex-5-enamide |
|---|---|
| PubChem CID | 118550439 |
| Molecular Formula | C21H39NO8 |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | (2S,3S)-2-hydroxy-N-[(S)-[(2S,4R,6R)-4-hydroxy-6-[(2S)-2-hydroxy-3-methoxypropyl]-5,5-dimethyloxan-2-yl]-methoxymethyl]-3-methoxy-5-methylhex-5-enamide |
| SMILES | C=C(C)C[C@H](OC)[C@H](O)C(=O)N[C@@H](OC)[C@@H]1C[C@@H](O)C(C)(C)[C@@H](C[C@H](O)COC)O1 |
| InChI | InChI=1S/C21H39NO8/c1-12(2)8-14(28-6)18(25)19(26)22-20(29-7)15-10-16(24)21(3,4)17(30-15)9-13(23)11-27-5/h13-18,20,23-25H,1,8-11H2,2-7H3,(H,22,26)/t13-,14-,15-,16+,17+,18-,20-/m0/s1 |
| InChIKey | SQQNBIRVYHEXIB-KYLUGMDTSA-N |
| XLogP | 0.36 |
| TPSA | 126.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|