About (3S,5R)-1-[2-(2-methylphenyl)ethyl]piperidine-3,5-diamine
(3S,5R)-1-[2-(2-methylphenyl)ethyl]piperidine-3,5-diamine (PubChem CID 118550566) has the molecular formula C14H23N3
and a molecular weight of 233.36 g/mol. Its IUPAC name is (3S,5R)-1-[2-(2-methylphenyl)ethyl]piperidine-3,5-diamine.
Molecular Properties
| Compound Name | (3S,5R)-1-[2-(2-methylphenyl)ethyl]piperidine-3,5-diamine |
| PubChem CID | 118550566 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | (3S,5R)-1-[2-(2-methylphenyl)ethyl]piperidine-3,5-diamine |
| SMILES | Cc1ccccc1CCN1C[C@H](N)C[C@H](N)C1 |
| InChI | InChI=1S/C14H23N3/c1-11-4-2-3-5-12(11)6-7-17-9-13(15)8-14(16)10-17/h2-5,13-14H,6-10,15-16H2,1H3/t13-,14+ |
| InChIKey | FZMWEHKBPRKUDU-OKILXGFUSA-N |
| XLogP | 0.90 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,5R)-1-[2-(2-methylphenyl)ethyl]piperidine-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5R)-1-[2-(2-methylphenyl)ethyl]piperidine-3,5-diamine?
The IUPAC name of (3S,5R)-1-[2-(2-methylphenyl)ethyl]piperidine-3,5-diamine (CID 118550566) is (3S,5R)-1-[2-(2-methylphenyl)ethyl]piperidine-3,5-diamine.
What is the SMILES notation for (3S,5R)-1-[2-(2-methylphenyl)ethyl]piperidine-3,5-diamine?
The canonical SMILES for (3S,5R)-1-[2-(2-methylphenyl)ethyl]piperidine-3,5-diamine is Cc1ccccc1CCN1C[C@H](N)C[C@H](N)C1.
What is the InChIKey of (3S,5R)-1-[2-(2-methylphenyl)ethyl]piperidine-3,5-diamine?
The InChIKey is FZMWEHKBPRKUDU-OKILXGFUSA-N. The full InChI is InChI=1S/C14H23N3/c1-11-4-2-3-5-12(11)6-7-17-9-13(15)8-14(16)10-17/h2-5,13-14H,6-10,15-16H2,1H3/t13-,14+.
What are the key properties of (3S,5R)-1-[2-(2-methylphenyl)ethyl]piperidine-3,5-diamine?
(3S,5R)-1-[2-(2-methylphenyl)ethyl]piperidine-3,5-diamine has a molecular weight of 233.36 g/mol, XLogP of 0.90, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5R)-1-[2-(2-methylphenyl)ethyl]piperidine-3,5-diamine is sourced from PubChem (CID 118550566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).