C14H21N3 — CID 118550578
(3R,5S)-1-(2,3-dihydro-1H-inden-2-yl)piperidine-3,5-diamine (PubChem CID 118550578) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is (3R,5S)-1-(2,3-dihydro-1H-inden-2-yl)piperidine-3,5-diamine.
| Compound Name | (3R,5S)-1-(2,3-dihydro-1H-inden-2-yl)piperidine-3,5-diamine |
|---|---|
| PubChem CID | 118550578 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (3R,5S)-1-(2,3-dihydro-1H-inden-2-yl)piperidine-3,5-diamine |
| SMILES | N[C@@H]1C[C@H](N)CN(C2Cc3ccccc3C2)C1 |
| InChI | InChI=1S/C14H21N3/c15-12-7-13(16)9-17(8-12)14-5-10-3-1-2-4-11(10)6-14/h1-4,12-14H,5-9,15-16H2/t12-,13+ |
| InChIKey | ZWFZOVJWOAYHRG-BETUJISGSA-N |
| XLogP | 0.51 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |