C10H15F7O3 — CID 118550605
1-(2,2-difluoroethoxy)-1-[1-(2,2-difluoroethoxy)-2,2-difluoroethoxy]-2-fluorobutane (PubChem CID 118550605) has the molecular formula C10H15F7O3 and a molecular weight of 316.21 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)-1-[1-(2,2-difluoroethoxy)-2,2-difluoroethoxy]-2-fluorobutane.
| Compound Name | 1-(2,2-difluoroethoxy)-1-[1-(2,2-difluoroethoxy)-2,2-difluoroethoxy]-2-fluorobutane |
|---|---|
| PubChem CID | 118550605 |
| Molecular Formula | C10H15F7O3 |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 1-(2,2-difluoroethoxy)-1-[1-(2,2-difluoroethoxy)-2,2-difluoroethoxy]-2-fluorobutane |
| SMILES | CCC(F)C(OCC(F)F)OC(OCC(F)F)C(F)F |
| InChI | InChI=1S/C10H15F7O3/c1-2-5(11)9(18-3-6(12)13)20-10(8(16)17)19-4-7(14)15/h5-10H,2-4H2,1H3 |
| InChIKey | GXHRSVHCMOZGSZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|