C14H23N3 — CID 118550630
(3R,5S)-1-(3-phenylpropyl)piperidine-3,5-diamine (PubChem CID 118550630) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is (3R,5S)-1-(3-phenylpropyl)piperidine-3,5-diamine.
| Compound Name | (3R,5S)-1-(3-phenylpropyl)piperidine-3,5-diamine |
|---|---|
| PubChem CID | 118550630 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | (3R,5S)-1-(3-phenylpropyl)piperidine-3,5-diamine |
| SMILES | N[C@@H]1C[C@H](N)CN(CCCc2ccccc2)C1 |
| InChI | InChI=1S/C14H23N3/c15-13-9-14(16)11-17(10-13)8-4-7-12-5-2-1-3-6-12/h1-3,5-6,13-14H,4,7-11,15-16H2/t13-,14+ |
| InChIKey | FIBBLXURFIBEIG-OKILXGFUSA-N |
| XLogP | 0.98 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |