C14H21N3O2 — CID 118550657
1-[(3R,5S)-3,5-diaminopiperidin-1-yl]-2-(3-methoxyphenyl)ethanone (PubChem CID 118550657) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-[(3R,5S)-3,5-diaminopiperidin-1-yl]-2-(3-methoxyphenyl)ethanone.
| Compound Name | 1-[(3R,5S)-3,5-diaminopiperidin-1-yl]-2-(3-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 118550657 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 1-[(3R,5S)-3,5-diaminopiperidin-1-yl]-2-(3-methoxyphenyl)ethanone |
| SMILES | COc1cccc(CC(=O)N2C[C@H](N)C[C@H](N)C2)c1 |
| InChI | InChI=1S/C14H21N3O2/c1-19-13-4-2-3-10(5-13)6-14(18)17-8-11(15)7-12(16)9-17/h2-5,11-12H,6-9,15-16H2,1H3/t11-,12+ |
| InChIKey | GFDOIOMFFSHJKC-TXEJJXNPSA-N |
| XLogP | 0.12 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |