C25H26N4O5S — CID 11855066
(3S,4S)-N-hydroxy-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]-1-prop-2-ynylpyrrolidine-3-carboxamide (PubChem CID 11855066) has the molecular formula C25H26N4O5S and a molecular weight of 494.57 g/mol. Its IUPAC name is (3S,4S)-N-hydroxy-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]-1-prop-2-ynylpyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-N-hydroxy-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]-1-prop-2-ynylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 11855066 |
| Molecular Formula | C25H26N4O5S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | (3S,4S)-N-hydroxy-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]-1-prop-2-ynylpyrrolidine-3-carboxamide |
| SMILES | C#CCN1C[C@H](C(=O)NO)[C@H](NS(=O)(=O)c2ccc(OCc3cc(C)nc4ccccc34)cc2)C1 |
| InChI | InChI=1S/C25H26N4O5S/c1-3-12-29-14-22(25(30)27-31)24(15-29)28-35(32,33)20-10-8-19(9-11-20)34-16-18-13-17(2)26-23-7-5-4-6-21(18)23/h1,4-11,13,22,24,28,31H,12,14-16H2,2H3,(H,27,30)/t22-,24+/m0/s1 |
| InChIKey | BGZRRZZFIZMAOA-LADGPHEKSA-N |
| XLogP | 1.84 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|