C24H26N4O6S — CID 11855067
(3S,4S)-1-acetyl-N-hydroxy-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]pyrrolidine-3-carboxamide (PubChem CID 11855067) has the molecular formula C24H26N4O6S and a molecular weight of 498.56 g/mol. Its IUPAC name is (3S,4S)-1-acetyl-N-hydroxy-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]pyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-1-acetyl-N-hydroxy-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 11855067 |
| Molecular Formula | C24H26N4O6S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | (3S,4S)-1-acetyl-N-hydroxy-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]pyrrolidine-3-carboxamide |
| SMILES | CC(=O)N1C[C@H](C(=O)NO)[C@H](NS(=O)(=O)c2ccc(OCc3cc(C)nc4ccccc34)cc2)C1 |
| InChI | InChI=1S/C24H26N4O6S/c1-15-11-17(20-5-3-4-6-22(20)25-15)14-34-18-7-9-19(10-8-18)35(32,33)27-23-13-28(16(2)29)12-21(23)24(30)26-31/h3-11,21,23,27,31H,12-14H2,1-2H3,(H,26,30)/t21-,23+/m0/s1 |
| InChIKey | VYRWTBBBKYEYEH-JTHBVZDNSA-N |
| XLogP | 1.75 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|