C23H24N4O6S — CID 11855068
(3S,4S)-1-formyl-N-hydroxy-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]pyrrolidine-3-carboxamide (PubChem CID 11855068) has the molecular formula C23H24N4O6S and a molecular weight of 484.53 g/mol. Its IUPAC name is (3S,4S)-1-formyl-N-hydroxy-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]pyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-1-formyl-N-hydroxy-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 11855068 |
| Molecular Formula | C23H24N4O6S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | (3S,4S)-1-formyl-N-hydroxy-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]pyrrolidine-3-carboxamide |
| SMILES | Cc1cc(COc2ccc(S(=O)(=O)N[C@@H]3CN(C=O)C[C@@H]3C(=O)NO)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C23H24N4O6S/c1-15-10-16(19-4-2-3-5-21(19)24-15)13-33-17-6-8-18(9-7-17)34(31,32)26-22-12-27(14-28)11-20(22)23(29)25-30/h2-10,14,20,22,26,30H,11-13H2,1H3,(H,25,29)/t20-,22+/m0/s1 |
| InChIKey | GFEBLWFWQAPHPF-RBBKRZOGSA-N |
| XLogP | 1.36 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|