C27H32N4O7S — CID 11855069
tert-butyl (3S,4S)-3-(hydroxycarbamoyl)-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]pyrrolidine-1-carboxylate (PubChem CID 11855069) has the molecular formula C27H32N4O7S and a molecular weight of 556.64 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-(hydroxycarbamoyl)-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3-(hydroxycarbamoyl)-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11855069 |
| Molecular Formula | C27H32N4O7S |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | tert-butyl (3S,4S)-3-(hydroxycarbamoyl)-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]pyrrolidine-1-carboxylate |
| SMILES | Cc1cc(COc2ccc(S(=O)(=O)N[C@@H]3CN(C(=O)OC(C)(C)C)C[C@@H]3C(=O)NO)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C27H32N4O7S/c1-17-13-18(21-7-5-6-8-23(21)28-17)16-37-19-9-11-20(12-10-19)39(35,36)30-24-15-31(14-22(24)25(32)29-34)26(33)38-27(2,3)4/h5-13,22,24,30,34H,14-16H2,1-4H3,(H,29,32)/t22-,24+/m0/s1 |
| InChIKey | NJDQLRBZXNPZKN-LADGPHEKSA-N |
| XLogP | 3.14 |
| TPSA | 147.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|