C19H22F4N2O3 — CID 118550909
methyl (6S)-6-fluoro-7-methoxy-15-(trifluoromethyl)-4,12-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),14,16-triene-9-carboxylate (PubChem CID 118550909) has the molecular formula C19H22F4N2O3 and a molecular weight of 402.39 g/mol. Its IUPAC name is methyl (6S)-6-fluoro-7-methoxy-15-(trifluoromethyl)-4,12-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),14,16-triene-9-carboxylate.
| Compound Name | methyl (6S)-6-fluoro-7-methoxy-15-(trifluoromethyl)-4,12-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),14,16-triene-9-carboxylate |
|---|---|
| PubChem CID | 118550909 |
| Molecular Formula | C19H22F4N2O3 |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | methyl (6S)-6-fluoro-7-methoxy-15-(trifluoromethyl)-4,12-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),14,16-triene-9-carboxylate |
| SMILES | COC(=O)C1CCN2c3cc(C(F)(F)F)ccc3C3CNC[C@]3(F)C2(OC)C1 |
| InChI | InChI=1S/C19H22F4N2O3/c1-27-16(26)11-5-6-25-15-7-12(19(21,22)23)3-4-13(15)14-9-24-10-17(14,20)18(25,8-11)28-2/h3-4,7,11,14,24H,5-6,8-10H2,1-2H3/t11?,14?,17-,18?/m1/s1 |
| InChIKey | KUNJBGRYQBHMRI-OCYJAMAZSA-N |
| XLogP | 2.85 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |