C32H64N8 — CID 118551575
1,4,7,10-tetrakis(piperidin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane (PubChem CID 118551575) has the molecular formula C32H64N8 and a molecular weight of 560.92 g/mol. Its IUPAC name is 1,4,7,10-tetrakis(piperidin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane.
| Compound Name | 1,4,7,10-tetrakis(piperidin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 118551575 |
| Molecular Formula | C32H64N8 |
| Molecular Weight | 560.92 g/mol |
| Exact Mass | 560.53 |
| IUPAC Name | 1,4,7,10-tetrakis(piperidin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane |
| SMILES | C1CCC(CN2CCN(CC3CCCCN3)CCN(CC3CCCCN3)CCN(CC3CCCCN3)CC2)NC1 |
| InChI | InChI=1S/C32H64N8/c1-5-13-33-29(9-1)25-37-17-19-38(26-30-10-2-6-14-34-30)21-23-40(28-32-12-4-8-16-36-32)24-22-39(20-18-37)27-31-11-3-7-15-35-31/h29-36H,1-28H2 |
| InChIKey | KERIRIMPEVIEHK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.92 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |