About N-[1-(3-methoxy-5-oxo-2-propyl-2H-pyrrol-1-yl)-1-oxopentan-2-yl]-2,2-dimethylpropanamide
N-[1-(3-methoxy-5-oxo-2-propyl-2H-pyrrol-1-yl)-1-oxopentan-2-yl]-2,2-dimethylpropanamide (PubChem CID 118551668) has the molecular formula C18H30N2O4
and a molecular weight of 338.45 g/mol. Its IUPAC name is N-[1-(3-methoxy-5-oxo-2-propyl-2H-pyrrol-1-yl)-1-oxopentan-2-yl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[1-(3-methoxy-5-oxo-2-propyl-2H-pyrrol-1-yl)-1-oxopentan-2-yl]-2,2-dimethylpropanamide |
| PubChem CID | 118551668 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | N-[1-(3-methoxy-5-oxo-2-propyl-2H-pyrrol-1-yl)-1-oxopentan-2-yl]-2,2-dimethylpropanamide |
| SMILES | CCCC(NC(=O)C(C)(C)C)C(=O)N1C(=O)C=C(OC)C1CCC |
| InChI | InChI=1S/C18H30N2O4/c1-7-9-12(19-17(23)18(3,4)5)16(22)20-13(10-8-2)14(24-6)11-15(20)21/h11-13H,7-10H2,1-6H3,(H,19,23) |
| InChIKey | ALJYDMNCICPCEP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-(3-methoxy-5-oxo-2-propyl-2H-pyrrol-1-yl)-1-oxopentan-2-yl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(3-methoxy-5-oxo-2-propyl-2H-pyrrol-1-yl)-1-oxopentan-2-yl]-2,2-dimethylpropanamide?
The IUPAC name of N-[1-(3-methoxy-5-oxo-2-propyl-2H-pyrrol-1-yl)-1-oxopentan-2-yl]-2,2-dimethylpropanamide (CID 118551668) is N-[1-(3-methoxy-5-oxo-2-propyl-2H-pyrrol-1-yl)-1-oxopentan-2-yl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[1-(3-methoxy-5-oxo-2-propyl-2H-pyrrol-1-yl)-1-oxopentan-2-yl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[1-(3-methoxy-5-oxo-2-propyl-2H-pyrrol-1-yl)-1-oxopentan-2-yl]-2,2-dimethylpropanamide is CCCC(NC(=O)C(C)(C)C)C(=O)N1C(=O)C=C(OC)C1CCC.
What is the InChIKey of N-[1-(3-methoxy-5-oxo-2-propyl-2H-pyrrol-1-yl)-1-oxopentan-2-yl]-2,2-dimethylpropanamide?
The InChIKey is ALJYDMNCICPCEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2O4/c1-7-9-12(19-17(23)18(3,4)5)16(22)20-13(10-8-2)14(24-6)11-15(20)21/h11-13H,7-10H2,1-6H3,(H,19,23).
What are the key properties of N-[1-(3-methoxy-5-oxo-2-propyl-2H-pyrrol-1-yl)-1-oxopentan-2-yl]-2,2-dimethylpropanamide?
N-[1-(3-methoxy-5-oxo-2-propyl-2H-pyrrol-1-yl)-1-oxopentan-2-yl]-2,2-dimethylpropanamide has a molecular weight of 338.45 g/mol, XLogP of 2.39, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(3-methoxy-5-oxo-2-propyl-2H-pyrrol-1-yl)-1-oxopentan-2-yl]-2,2-dimethylpropanamide is sourced from PubChem (CID 118551668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).