About 5-[2-(2-methyl-1,3-thiazol-5-yl)-1H-indol-4-yl]-2-(oxan-4-yloxy)benzonitrile
5-[2-(2-methyl-1,3-thiazol-5-yl)-1H-indol-4-yl]-2-(oxan-4-yloxy)benzonitrile (PubChem CID 118551919) has the molecular formula C24H21N3O2S
and a molecular weight of 415.52 g/mol. Its IUPAC name is 5-[2-(2-methyl-1,3-thiazol-5-yl)-1H-indol-4-yl]-2-(oxan-4-yloxy)benzonitrile.
Molecular Properties
| Compound Name | 5-[2-(2-methyl-1,3-thiazol-5-yl)-1H-indol-4-yl]-2-(oxan-4-yloxy)benzonitrile |
| PubChem CID | 118551919 |
| Molecular Formula | C24H21N3O2S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 5-[2-(2-methyl-1,3-thiazol-5-yl)-1H-indol-4-yl]-2-(oxan-4-yloxy)benzonitrile |
| SMILES | Cc1ncc(-c2cc3c(-c4ccc(OC5CCOCC5)c(C#N)c4)cccc3[nH]2)s1 |
| InChI | InChI=1S/C24H21N3O2S/c1-15-26-14-24(30-15)22-12-20-19(3-2-4-21(20)27-22)16-5-6-23(17(11-16)13-25)29-18-7-9-28-10-8-18/h2-6,11-12,14,18,27H,7-10H2,1H3 |
| InChIKey | BOMIELIKEJKWCP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[2-(2-methyl-1,3-thiazol-5-yl)-1H-indol-4-yl]-2-(oxan-4-yloxy)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2-methyl-1,3-thiazol-5-yl)-1H-indol-4-yl]-2-(oxan-4-yloxy)benzonitrile?
The IUPAC name of 5-[2-(2-methyl-1,3-thiazol-5-yl)-1H-indol-4-yl]-2-(oxan-4-yloxy)benzonitrile (CID 118551919) is 5-[2-(2-methyl-1,3-thiazol-5-yl)-1H-indol-4-yl]-2-(oxan-4-yloxy)benzonitrile.
What is the SMILES notation for 5-[2-(2-methyl-1,3-thiazol-5-yl)-1H-indol-4-yl]-2-(oxan-4-yloxy)benzonitrile?
The canonical SMILES for 5-[2-(2-methyl-1,3-thiazol-5-yl)-1H-indol-4-yl]-2-(oxan-4-yloxy)benzonitrile is Cc1ncc(-c2cc3c(-c4ccc(OC5CCOCC5)c(C#N)c4)cccc3[nH]2)s1.
What is the InChIKey of 5-[2-(2-methyl-1,3-thiazol-5-yl)-1H-indol-4-yl]-2-(oxan-4-yloxy)benzonitrile?
The InChIKey is BOMIELIKEJKWCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21N3O2S/c1-15-26-14-24(30-15)22-12-20-19(3-2-4-21(20)27-22)16-5-6-23(17(11-16)13-25)29-18-7-9-28-10-8-18/h2-6,11-12,14,18,27H,7-10H2,1H3.
What are the key properties of 5-[2-(2-methyl-1,3-thiazol-5-yl)-1H-indol-4-yl]-2-(oxan-4-yloxy)benzonitrile?
5-[2-(2-methyl-1,3-thiazol-5-yl)-1H-indol-4-yl]-2-(oxan-4-yloxy)benzonitrile has a molecular weight of 415.52 g/mol, XLogP of 5.70, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2-methyl-1,3-thiazol-5-yl)-1H-indol-4-yl]-2-(oxan-4-yloxy)benzonitrile is sourced from PubChem (CID 118551919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).