C20H26FN3O — CID 118552874
N-(2-cyclohexylethyl)-N-[(2-fluorophenyl)methyl]-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 118552874) has the molecular formula C20H26FN3O and a molecular weight of 343.45 g/mol. Its IUPAC name is N-(2-cyclohexylethyl)-N-[(2-fluorophenyl)methyl]-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(2-cyclohexylethyl)-N-[(2-fluorophenyl)methyl]-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 118552874 |
| Molecular Formula | C20H26FN3O |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | N-(2-cyclohexylethyl)-N-[(2-fluorophenyl)methyl]-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(CCC2CCCCC2)Cc2ccccc2F)n[nH]1 |
| InChI | InChI=1S/C20H26FN3O/c1-15-13-19(23-22-15)20(25)24(12-11-16-7-3-2-4-8-16)14-17-9-5-6-10-18(17)21/h5-6,9-10,13,16H,2-4,7-8,11-12,14H2,1H3,(H,22,23) |
| InChIKey | BDNHIHJGUGRVKD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |