About 9,9-bis(azidomethyl)-2,7-dimethylfluorene
9,9-bis(azidomethyl)-2,7-dimethylfluorene (PubChem CID 118552963) has the molecular formula C17H16N6
and a molecular weight of 304.36 g/mol. Its IUPAC name is 9,9-bis(azidomethyl)-2,7-dimethylfluorene.
Molecular Properties
| Compound Name | 9,9-bis(azidomethyl)-2,7-dimethylfluorene |
| PubChem CID | 118552963 |
| Molecular Formula | C17H16N6 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 9,9-bis(azidomethyl)-2,7-dimethylfluorene |
| SMILES | Cc1ccc2c(c1)C(CN=[N+]=[N-])(CN=[N+]=[N-])c1cc(C)ccc1-2 |
| InChI | InChI=1S/C17H16N6/c1-11-3-5-13-14-6-4-12(2)8-16(14)17(9-20-22-18,10-21-23-19)15(13)7-11/h3-8H,9-10H2,1-2H3 |
| InChIKey | TUJIKTCMIMMFDE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 9,9-bis(azidomethyl)-2,7-dimethylfluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-bis(azidomethyl)-2,7-dimethylfluorene?
The IUPAC name of 9,9-bis(azidomethyl)-2,7-dimethylfluorene (CID 118552963) is 9,9-bis(azidomethyl)-2,7-dimethylfluorene.
What is the SMILES notation for 9,9-bis(azidomethyl)-2,7-dimethylfluorene?
The canonical SMILES for 9,9-bis(azidomethyl)-2,7-dimethylfluorene is Cc1ccc2c(c1)C(CN=[N+]=[N-])(CN=[N+]=[N-])c1cc(C)ccc1-2.
What is the InChIKey of 9,9-bis(azidomethyl)-2,7-dimethylfluorene?
The InChIKey is TUJIKTCMIMMFDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N6/c1-11-3-5-13-14-6-4-12(2)8-16(14)17(9-20-22-18,10-21-23-19)15(13)7-11/h3-8H,9-10H2,1-2H3.
What are the key properties of 9,9-bis(azidomethyl)-2,7-dimethylfluorene?
9,9-bis(azidomethyl)-2,7-dimethylfluorene has a molecular weight of 304.36 g/mol, XLogP of 5.19, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-bis(azidomethyl)-2,7-dimethylfluorene is sourced from PubChem (CID 118552963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).