About (6-amino-3-methyl-1,2-benzoxazol-5-yl)-dideuteriomethanol
(6-amino-3-methyl-1,2-benzoxazol-5-yl)-dideuteriomethanol (PubChem CID 118553098) has the molecular formula C9H10N2O2
and a molecular weight of 180.20 g/mol. Its IUPAC name is (6-amino-3-methyl-1,2-benzoxazol-5-yl)-dideuteriomethanol.
Molecular Properties
| Compound Name | (6-amino-3-methyl-1,2-benzoxazol-5-yl)-dideuteriomethanol |
| PubChem CID | 118553098 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (6-amino-3-methyl-1,2-benzoxazol-5-yl)-dideuteriomethanol |
| SMILES | [2H]C([2H])(O)c1cc2c(C)noc2cc1N |
| InChI | InChI=1S/C9H10N2O2/c1-5-7-2-6(4-12)8(10)3-9(7)13-11-5/h2-3,12H,4,10H2,1H3/i4D2 |
| InChIKey | SETIDIZZSYEVGP-APZFVMQVSA-N |
| XLogP | 1.21 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (6-amino-3-methyl-1,2-benzoxazol-5-yl)-dideuteriomethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-amino-3-methyl-1,2-benzoxazol-5-yl)-dideuteriomethanol?
The IUPAC name of (6-amino-3-methyl-1,2-benzoxazol-5-yl)-dideuteriomethanol (CID 118553098) is (6-amino-3-methyl-1,2-benzoxazol-5-yl)-dideuteriomethanol.
What is the SMILES notation for (6-amino-3-methyl-1,2-benzoxazol-5-yl)-dideuteriomethanol?
The canonical SMILES for (6-amino-3-methyl-1,2-benzoxazol-5-yl)-dideuteriomethanol is [2H]C([2H])(O)c1cc2c(C)noc2cc1N.
What is the InChIKey of (6-amino-3-methyl-1,2-benzoxazol-5-yl)-dideuteriomethanol?
The InChIKey is SETIDIZZSYEVGP-APZFVMQVSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-5-7-2-6(4-12)8(10)3-9(7)13-11-5/h2-3,12H,4,10H2,1H3/i4D2.
What are the key properties of (6-amino-3-methyl-1,2-benzoxazol-5-yl)-dideuteriomethanol?
(6-amino-3-methyl-1,2-benzoxazol-5-yl)-dideuteriomethanol has a molecular weight of 180.20 g/mol, XLogP of 1.21, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-amino-3-methyl-1,2-benzoxazol-5-yl)-dideuteriomethanol is sourced from PubChem (CID 118553098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).