C22H23N3O6S — CID 11855328
(3R,4S)-N-hydroxy-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]oxolane-3-carboxamide (PubChem CID 11855328) has the molecular formula C22H23N3O6S and a molecular weight of 457.51 g/mol. Its IUPAC name is (3R,4S)-N-hydroxy-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]oxolane-3-carboxamide.
| Compound Name | (3R,4S)-N-hydroxy-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 11855328 |
| Molecular Formula | C22H23N3O6S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | (3R,4S)-N-hydroxy-4-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]oxolane-3-carboxamide |
| SMILES | Cc1cc(COc2ccc(S(=O)(=O)N[C@@H]3COC[C@@H]3C(=O)NO)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C22H23N3O6S/c1-14-10-15(18-4-2-3-5-20(18)23-14)11-31-16-6-8-17(9-7-16)32(28,29)25-21-13-30-12-19(21)22(26)24-27/h2-10,19,21,25,27H,11-13H2,1H3,(H,24,26)/t19-,21+/m0/s1 |
| InChIKey | STQWVQNLHJHEFT-PZJWPPBQSA-N |
| XLogP | 1.92 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|