C20H26F2N2O5S — CID 118553303
tert-butyl N-[(4aS,7aS)-7-(fluoromethyl)-4a-(2-fluorophenyl)-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-3-yl]carbamate (PubChem CID 118553303) has the molecular formula C20H26F2N2O5S and a molecular weight of 444.50 g/mol. Its IUPAC name is tert-butyl N-[(4aS,7aS)-7-(fluoromethyl)-4a-(2-fluorophenyl)-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(4aS,7aS)-7-(fluoromethyl)-4a-(2-fluorophenyl)-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 118553303 |
| Molecular Formula | C20H26F2N2O5S |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | tert-butyl N-[(4aS,7aS)-7-(fluoromethyl)-4a-(2-fluorophenyl)-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=N[C@@]2(c3ccccc3F)COC(CF)[C@H]2S(=O)(=O)C1(C)C |
| InChI | InChI=1S/C20H26F2N2O5S/c1-18(2,3)29-17(25)23-16-19(4,5)30(26,27)15-14(10-21)28-11-20(15,24-16)12-8-6-7-9-13(12)22/h6-9,14-15H,10-11H2,1-5H3,(H,23,24,25)/t14?,15-,20-/m1/s1 |
| InChIKey | VSZRPDCPMHHWDC-XUERPSFUSA-N |
| XLogP | 2.89 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |