C16H19FN2O5S — CID 118553305
methyl (4aS,7aS)-3-amino-4a-(2-fluorophenyl)-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazine-7-carboxylate (PubChem CID 118553305) has the molecular formula C16H19FN2O5S and a molecular weight of 370.40 g/mol. Its IUPAC name is methyl (4aS,7aS)-3-amino-4a-(2-fluorophenyl)-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazine-7-carboxylate.
| Compound Name | methyl (4aS,7aS)-3-amino-4a-(2-fluorophenyl)-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazine-7-carboxylate |
|---|---|
| PubChem CID | 118553305 |
| Molecular Formula | C16H19FN2O5S |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | methyl (4aS,7aS)-3-amino-4a-(2-fluorophenyl)-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazine-7-carboxylate |
| SMILES | COC(=O)C1OC[C@]2(c3ccccc3F)N=C(N)C(C)(C)S(=O)(=O)[C@H]12 |
| InChI | InChI=1S/C16H19FN2O5S/c1-15(2)14(18)19-16(9-6-4-5-7-10(9)17)8-24-11(13(20)23-3)12(16)25(15,21)22/h4-7,11-12H,8H2,1-3H3,(H2,18,19)/t11?,12-,16-/m1/s1 |
| InChIKey | FKMUKPSBBGBGEA-ZLXOECBPSA-N |
| XLogP | 0.53 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |