C17H20FNO3S — CID 118553334
(4aS,7aS)-2-cyclopropyl-4a-(2-fluorophenyl)-2-methyl-3-methylidene-4,5,7,7a-tetrahydrofuro[3,4-b][1,4]thiazine 1,1-dioxide (PubChem CID 118553334) has the molecular formula C17H20FNO3S and a molecular weight of 337.42 g/mol. Its IUPAC name is (4aS,7aS)-2-cyclopropyl-4a-(2-fluorophenyl)-2-methyl-3-methylidene-4,5,7,7a-tetrahydrofuro[3,4-b][1,4]thiazine 1,1-dioxide.
| Compound Name | (4aS,7aS)-2-cyclopropyl-4a-(2-fluorophenyl)-2-methyl-3-methylidene-4,5,7,7a-tetrahydrofuro[3,4-b][1,4]thiazine 1,1-dioxide |
|---|---|
| PubChem CID | 118553334 |
| Molecular Formula | C17H20FNO3S |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | (4aS,7aS)-2-cyclopropyl-4a-(2-fluorophenyl)-2-methyl-3-methylidene-4,5,7,7a-tetrahydrofuro[3,4-b][1,4]thiazine 1,1-dioxide |
| SMILES | C=C1N[C@@]2(c3ccccc3F)COC[C@H]2S(=O)(=O)C1(C)C1CC1 |
| InChI | InChI=1S/C17H20FNO3S/c1-11-16(2,12-7-8-12)23(20,21)15-9-22-10-17(15,19-11)13-5-3-4-6-14(13)18/h3-6,12,15,19H,1,7-10H2,2H3/t15-,16?,17-/m1/s1 |
| InChIKey | XDGNEIVUAMGPMG-PWZMFNOBSA-N |
| XLogP | 2.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |