About 2-hydroxy-1-(3-methyl-2,5-dihydropyrrol-1-yl)ethanone
2-hydroxy-1-(3-methyl-2,5-dihydropyrrol-1-yl)ethanone (PubChem CID 118553654) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 2-hydroxy-1-(3-methyl-2,5-dihydropyrrol-1-yl)ethanone.
Molecular Properties
| Compound Name | 2-hydroxy-1-(3-methyl-2,5-dihydropyrrol-1-yl)ethanone |
| PubChem CID | 118553654 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 2-hydroxy-1-(3-methyl-2,5-dihydropyrrol-1-yl)ethanone |
| SMILES | CC1=CCN(C(=O)CO)C1 |
| InChI | InChI=1S/C7H11NO2/c1-6-2-3-8(4-6)7(10)5-9/h2,9H,3-5H2,1H3 |
| InChIKey | VDKNBDBFJJMKPV-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-1-(3-methyl-2,5-dihydropyrrol-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1-(3-methyl-2,5-dihydropyrrol-1-yl)ethanone?
The IUPAC name of 2-hydroxy-1-(3-methyl-2,5-dihydropyrrol-1-yl)ethanone (CID 118553654) is 2-hydroxy-1-(3-methyl-2,5-dihydropyrrol-1-yl)ethanone.
What is the SMILES notation for 2-hydroxy-1-(3-methyl-2,5-dihydropyrrol-1-yl)ethanone?
The canonical SMILES for 2-hydroxy-1-(3-methyl-2,5-dihydropyrrol-1-yl)ethanone is CC1=CCN(C(=O)CO)C1.
What is the InChIKey of 2-hydroxy-1-(3-methyl-2,5-dihydropyrrol-1-yl)ethanone?
The InChIKey is VDKNBDBFJJMKPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-6-2-3-8(4-6)7(10)5-9/h2,9H,3-5H2,1H3.
What are the key properties of 2-hydroxy-1-(3-methyl-2,5-dihydropyrrol-1-yl)ethanone?
2-hydroxy-1-(3-methyl-2,5-dihydropyrrol-1-yl)ethanone has a molecular weight of 141.17 g/mol, XLogP of -0.23, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1-(3-methyl-2,5-dihydropyrrol-1-yl)ethanone is sourced from PubChem (CID 118553654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).