C31H32F2N8O3 — CID 118553660
5-[8-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]phenyl]-7H-purin-6-yl]-2-[1-(2-hydroxyacetyl)piperidin-4-yl]oxybenzonitrile (PubChem CID 118553660) has the molecular formula C31H32F2N8O3 and a molecular weight of 602.65 g/mol. Its IUPAC name is 5-[8-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]phenyl]-7H-purin-6-yl]-2-[1-(2-hydroxyacetyl)piperidin-4-yl]oxybenzonitrile.
| Compound Name | 5-[8-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]phenyl]-7H-purin-6-yl]-2-[1-(2-hydroxyacetyl)piperidin-4-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 118553660 |
| Molecular Formula | C31H32F2N8O3 |
| Molecular Weight | 602.65 g/mol |
| Exact Mass | 602.26 |
| IUPAC Name | 5-[8-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]phenyl]-7H-purin-6-yl]-2-[1-(2-hydroxyacetyl)piperidin-4-yl]oxybenzonitrile |
| SMILES | N#Cc1cc(-c2ncnc3nc(-c4ccc(N5CCN(CC(F)F)CC5)cc4)[nH]c23)ccc1OC1CCN(C(=O)CO)CC1 |
| InChI | InChI=1S/C31H32F2N8O3/c32-26(33)17-39-11-13-40(14-12-39)23-4-1-20(2-5-23)30-37-29-28(35-19-36-31(29)38-30)21-3-6-25(22(15-21)16-34)44-24-7-9-41(10-8-24)27(43)18-42/h1-6,15,19,24,26,42H,7-14,17-18H2,(H,35,36,37,38) |
| InChIKey | NJHKIODSBLMIFA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 134.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.65 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|