About (3Z,5Z)-5-methyl-1-morpholin-4-ylhepta-3,5-dien-2-imine
(3Z,5Z)-5-methyl-1-morpholin-4-ylhepta-3,5-dien-2-imine (PubChem CID 118553670) has the molecular formula C12H20N2O
and a molecular weight of 208.31 g/mol. Its IUPAC name is (3Z,5Z)-5-methyl-1-morpholin-4-ylhepta-3,5-dien-2-imine.
Molecular Properties
| Compound Name | (3Z,5Z)-5-methyl-1-morpholin-4-ylhepta-3,5-dien-2-imine |
| PubChem CID | 118553670 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | (3Z,5Z)-5-methyl-1-morpholin-4-ylhepta-3,5-dien-2-imine |
| SMILES | [H]/N=C(\C=C/C(C)=C\C)CN1CCOCC1 |
| InChI | InChI=1S/C12H20N2O/c1-3-11(2)4-5-12(13)10-14-6-8-15-9-7-14/h3-5,13H,6-10H2,1-2H3/b5-4-,11-3-,13-12+ |
| InChIKey | GTBYHESHENMROV-NFVZFIAFSA-N |
| XLogP | 1.86 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5Z)-5-methyl-1-morpholin-4-ylhepta-3,5-dien-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5Z)-5-methyl-1-morpholin-4-ylhepta-3,5-dien-2-imine?
The IUPAC name of (3Z,5Z)-5-methyl-1-morpholin-4-ylhepta-3,5-dien-2-imine (CID 118553670) is (3Z,5Z)-5-methyl-1-morpholin-4-ylhepta-3,5-dien-2-imine.
What is the SMILES notation for (3Z,5Z)-5-methyl-1-morpholin-4-ylhepta-3,5-dien-2-imine?
The canonical SMILES for (3Z,5Z)-5-methyl-1-morpholin-4-ylhepta-3,5-dien-2-imine is [H]/N=C(\C=C/C(C)=C\C)CN1CCOCC1.
What is the InChIKey of (3Z,5Z)-5-methyl-1-morpholin-4-ylhepta-3,5-dien-2-imine?
The InChIKey is GTBYHESHENMROV-NFVZFIAFSA-N. The full InChI is InChI=1S/C12H20N2O/c1-3-11(2)4-5-12(13)10-14-6-8-15-9-7-14/h3-5,13H,6-10H2,1-2H3/b5-4-,11-3-,13-12+.
What are the key properties of (3Z,5Z)-5-methyl-1-morpholin-4-ylhepta-3,5-dien-2-imine?
(3Z,5Z)-5-methyl-1-morpholin-4-ylhepta-3,5-dien-2-imine has a molecular weight of 208.31 g/mol, XLogP of 1.86, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5Z)-5-methyl-1-morpholin-4-ylhepta-3,5-dien-2-imine is sourced from PubChem (CID 118553670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).