C21H19F3N6OS2 — CID 118554277
(7S)-4-(1,2,3-benzothiadiazol-6-ylamino)-N-methyl-N-(3,3,3-trifluoropropyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 118554277) has the molecular formula C21H19F3N6OS2 and a molecular weight of 492.55 g/mol. Its IUPAC name is (7S)-4-(1,2,3-benzothiadiazol-6-ylamino)-N-methyl-N-(3,3,3-trifluoropropyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | (7S)-4-(1,2,3-benzothiadiazol-6-ylamino)-N-methyl-N-(3,3,3-trifluoropropyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 118554277 |
| Molecular Formula | C21H19F3N6OS2 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | (7S)-4-(1,2,3-benzothiadiazol-6-ylamino)-N-methyl-N-(3,3,3-trifluoropropyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CN(CCC(F)(F)F)C(=O)[C@H]1CCc2c(sc3ncnc(Nc4ccc5nnsc5c4)c23)C1 |
| InChI | InChI=1S/C21H19F3N6OS2/c1-30(7-6-21(22,23)24)20(31)11-2-4-13-15(8-11)32-19-17(13)18(25-10-26-19)27-12-3-5-14-16(9-12)33-29-28-14/h3,5,9-11H,2,4,6-8H2,1H3,(H,25,26,27)/t11-/m0/s1 |
| InChIKey | PIGDFBAIIRATQK-NSHDSACASA-N |
| XLogP | 4.96 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |