C20H17F3N6OS2 — CID 118554281
(7S)-4-(1,2,3-benzothiadiazol-6-ylamino)-N-(3,3,3-trifluoropropyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 118554281) has the molecular formula C20H17F3N6OS2 and a molecular weight of 478.53 g/mol. Its IUPAC name is (7S)-4-(1,2,3-benzothiadiazol-6-ylamino)-N-(3,3,3-trifluoropropyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | (7S)-4-(1,2,3-benzothiadiazol-6-ylamino)-N-(3,3,3-trifluoropropyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 118554281 |
| Molecular Formula | C20H17F3N6OS2 |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | (7S)-4-(1,2,3-benzothiadiazol-6-ylamino)-N-(3,3,3-trifluoropropyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | O=C(NCCC(F)(F)F)[C@H]1CCc2c(sc3ncnc(Nc4ccc5nnsc5c4)c23)C1 |
| InChI | InChI=1S/C20H17F3N6OS2/c21-20(22,23)5-6-24-18(30)10-1-3-12-14(7-10)31-19-16(12)17(25-9-26-19)27-11-2-4-13-15(8-11)32-29-28-13/h2,4,8-10H,1,3,5-7H2,(H,24,30)(H,25,26,27)/t10-/m0/s1 |
| InChIKey | SGAJOWHJIZXZTG-JTQLQIEISA-N |
| XLogP | 4.61 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |