C25H33N3O3 — CID 11855444
N-[(1S,3R)-5-carbamoyl-2-adamantyl]-3-methyl-2-oxo-1-[(1S)-1-phenylethyl]pyrrolidine-3-carboxamide (PubChem CID 11855444) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is N-[(1S,3R)-5-carbamoyl-2-adamantyl]-3-methyl-2-oxo-1-[(1S)-1-phenylethyl]pyrrolidine-3-carboxamide.
| Compound Name | N-[(1S,3R)-5-carbamoyl-2-adamantyl]-3-methyl-2-oxo-1-[(1S)-1-phenylethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 11855444 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | N-[(1S,3R)-5-carbamoyl-2-adamantyl]-3-methyl-2-oxo-1-[(1S)-1-phenylethyl]pyrrolidine-3-carboxamide |
| SMILES | C[C@@H](c1ccccc1)N1CCC(C)(C(=O)NC2[C@@H]3CC4C[C@H]2CC(C(N)=O)(C4)C3)C1=O |
| InChI | InChI=1S/C25H33N3O3/c1-15(17-6-4-3-5-7-17)28-9-8-24(2,23(28)31)22(30)27-20-18-10-16-11-19(20)14-25(12-16,13-18)21(26)29/h3-7,15-16,18-20H,8-14H2,1-2H3,(H2,26,29)(H,27,30)/t15-,16?,18-,19+,20?,24?,25?/m0/s1 |
| InChIKey | IJGOHNQEMBTXEF-PLKZNUFASA-N |
| XLogP | 2.78 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|