C15H18O4 — CID 118554454
5-[2-(2,5-dihydroxy-3-bicyclo[4.2.0]octa-1,3,5-trienyl)ethyl]-5-methyloxolan-2-one (PubChem CID 118554454) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is 5-[2-(2,5-dihydroxy-3-bicyclo[4.2.0]octa-1,3,5-trienyl)ethyl]-5-methyloxolan-2-one.
| Compound Name | 5-[2-(2,5-dihydroxy-3-bicyclo[4.2.0]octa-1,3,5-trienyl)ethyl]-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 118554454 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 5-[2-(2,5-dihydroxy-3-bicyclo[4.2.0]octa-1,3,5-trienyl)ethyl]-5-methyloxolan-2-one |
| SMILES | CC1(CCc2cc(O)c3c(c2O)CC3)CCC(=O)O1 |
| InChI | InChI=1S/C15H18O4/c1-15(7-5-13(17)19-15)6-4-9-8-12(16)10-2-3-11(10)14(9)18/h8,16,18H,2-7H2,1H3 |
| InChIKey | PMLIRLZDAJYMAT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|