C17H25FN2O3S — CID 118554519
3-(butoxymethyl)-3-(2-fluorophenyl)-6,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 118554519) has the molecular formula C17H25FN2O3S and a molecular weight of 356.46 g/mol. Its IUPAC name is 3-(butoxymethyl)-3-(2-fluorophenyl)-6,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | 3-(butoxymethyl)-3-(2-fluorophenyl)-6,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 118554519 |
| Molecular Formula | C17H25FN2O3S |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 3-(butoxymethyl)-3-(2-fluorophenyl)-6,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | CCCCOCC1(c2ccccc2F)CS(=O)(=O)C(C)(C)C(N)=N1 |
| InChI | InChI=1S/C17H25FN2O3S/c1-4-5-10-23-11-17(13-8-6-7-9-14(13)18)12-24(21,22)16(2,3)15(19)20-17/h6-9H,4-5,10-12H2,1-3H3,(H2,19,20) |
| InChIKey | IATTXKNWEUAPRQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|