C19H19F3N8O3S — CID 118554557
(2R)-2-methoxy-N-[5-[[(3R)-1-(1,2,4-triazin-6-yl)pyrrolidin-3-yl]amino]-1,3,4-thiadiazol-2-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide (PubChem CID 118554557) has the molecular formula C19H19F3N8O3S and a molecular weight of 496.48 g/mol. Its IUPAC name is (2R)-2-methoxy-N-[5-[[(3R)-1-(1,2,4-triazin-6-yl)pyrrolidin-3-yl]amino]-1,3,4-thiadiazol-2-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | (2R)-2-methoxy-N-[5-[[(3R)-1-(1,2,4-triazin-6-yl)pyrrolidin-3-yl]amino]-1,3,4-thiadiazol-2-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 118554557 |
| Molecular Formula | C19H19F3N8O3S |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | (2R)-2-methoxy-N-[5-[[(3R)-1-(1,2,4-triazin-6-yl)pyrrolidin-3-yl]amino]-1,3,4-thiadiazol-2-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
| SMILES | CO[C@@H](C(=O)Nc1nnc(N[C@@H]2CCN(c3cncnn3)C2)s1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C19H19F3N8O3S/c1-32-15(11-3-2-4-13(7-11)33-19(20,21)22)16(31)26-18-29-28-17(34-18)25-12-5-6-30(9-12)14-8-23-10-24-27-14/h2-4,7-8,10,12,15H,5-6,9H2,1H3,(H,25,28)(H,26,29,31)/t12-,15-/m1/s1 |
| InChIKey | MIVIOHXOLBNSSV-IUODEOHRSA-N |
| XLogP | 2.64 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |