C22H42N3O8P — CID 118554728
[(2S,3S)-1-azido-4-dibutoxyphosphoryloxy-3-pentanoyloxybutan-2-yl] pentanoate (PubChem CID 118554728) has the molecular formula C22H42N3O8P and a molecular weight of 507.57 g/mol. Its IUPAC name is [(2S,3S)-1-azido-4-dibutoxyphosphoryloxy-3-pentanoyloxybutan-2-yl] pentanoate.
| Compound Name | [(2S,3S)-1-azido-4-dibutoxyphosphoryloxy-3-pentanoyloxybutan-2-yl] pentanoate |
|---|---|
| PubChem CID | 118554728 |
| Molecular Formula | C22H42N3O8P |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | [(2S,3S)-1-azido-4-dibutoxyphosphoryloxy-3-pentanoyloxybutan-2-yl] pentanoate |
| SMILES | CCCCOP(=O)(OCCCC)OC[C@H](OC(=O)CCCC)[C@H](CN=[N+]=[N-])OC(=O)CCCC |
| InChI | InChI=1S/C22H42N3O8P/c1-5-9-13-21(26)32-19(17-24-25-23)20(33-22(27)14-10-6-2)18-31-34(28,29-15-11-7-3)30-16-12-8-4/h19-20H,5-18H2,1-4H3/t19-,20-/m0/s1 |
| InChIKey | RHFHJIFFALCCNF-PMACEKPBSA-N |
| XLogP | 6.26 |
| TPSA | 146.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|