About 6-amino-3-chloro-2-[(1S,3S)-3-hydroxycyclohexyl]sulfonylphenol
6-amino-3-chloro-2-[(1S,3S)-3-hydroxycyclohexyl]sulfonylphenol (PubChem CID 118554748) has the molecular formula C12H16ClNO4S
and a molecular weight of 305.78 g/mol. Its IUPAC name is 6-amino-3-chloro-2-[(1S,3S)-3-hydroxycyclohexyl]sulfonylphenol.
Molecular Properties
| Compound Name | 6-amino-3-chloro-2-[(1S,3S)-3-hydroxycyclohexyl]sulfonylphenol |
| PubChem CID | 118554748 |
| Molecular Formula | C12H16ClNO4S |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 6-amino-3-chloro-2-[(1S,3S)-3-hydroxycyclohexyl]sulfonylphenol |
| SMILES | Nc1ccc(Cl)c(S(=O)(=O)[C@H]2CCC[C@H](O)C2)c1O |
| InChI | InChI=1S/C12H16ClNO4S/c13-9-4-5-10(14)11(16)12(9)19(17,18)8-3-1-2-7(15)6-8/h4-5,7-8,15-16H,1-3,6,14H2/t7-,8-/m0/s1 |
| InChIKey | KSPCQWZXMRVMQO-YUMQZZPRSA-N |
| XLogP | 1.71 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-3-chloro-2-[(1S,3S)-3-hydroxycyclohexyl]sulfonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3-chloro-2-[(1S,3S)-3-hydroxycyclohexyl]sulfonylphenol?
The IUPAC name of 6-amino-3-chloro-2-[(1S,3S)-3-hydroxycyclohexyl]sulfonylphenol (CID 118554748) is 6-amino-3-chloro-2-[(1S,3S)-3-hydroxycyclohexyl]sulfonylphenol.
What is the SMILES notation for 6-amino-3-chloro-2-[(1S,3S)-3-hydroxycyclohexyl]sulfonylphenol?
The canonical SMILES for 6-amino-3-chloro-2-[(1S,3S)-3-hydroxycyclohexyl]sulfonylphenol is Nc1ccc(Cl)c(S(=O)(=O)[C@H]2CCC[C@H](O)C2)c1O.
What is the InChIKey of 6-amino-3-chloro-2-[(1S,3S)-3-hydroxycyclohexyl]sulfonylphenol?
The InChIKey is KSPCQWZXMRVMQO-YUMQZZPRSA-N. The full InChI is InChI=1S/C12H16ClNO4S/c13-9-4-5-10(14)11(16)12(9)19(17,18)8-3-1-2-7(15)6-8/h4-5,7-8,15-16H,1-3,6,14H2/t7-,8-/m0/s1.
What are the key properties of 6-amino-3-chloro-2-[(1S,3S)-3-hydroxycyclohexyl]sulfonylphenol?
6-amino-3-chloro-2-[(1S,3S)-3-hydroxycyclohexyl]sulfonylphenol has a molecular weight of 305.78 g/mol, XLogP of 1.71, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3-chloro-2-[(1S,3S)-3-hydroxycyclohexyl]sulfonylphenol is sourced from PubChem (CID 118554748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).