About 5-(2,2-difluoroethyl)-1,3-dihydrobenzimidazole-2-thione
5-(2,2-difluoroethyl)-1,3-dihydrobenzimidazole-2-thione (PubChem CID 118554909) has the molecular formula C9H8F2N2S
and a molecular weight of 214.24 g/mol. Its IUPAC name is 5-(2,2-difluoroethyl)-1,3-dihydrobenzimidazole-2-thione.
Molecular Properties
| Compound Name | 5-(2,2-difluoroethyl)-1,3-dihydrobenzimidazole-2-thione |
| PubChem CID | 118554909 |
| Molecular Formula | C9H8F2N2S |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 5-(2,2-difluoroethyl)-1,3-dihydrobenzimidazole-2-thione |
| SMILES | FC(F)Cc1ccc2[nH]c(=S)[nH]c2c1 |
| InChI | InChI=1S/C9H8F2N2S/c10-8(11)4-5-1-2-6-7(3-5)13-9(14)12-6/h1-3,8H,4H2,(H2,12,13,14) |
| InChIKey | JCHAVQIKSHFZIX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2-difluoroethyl)-1,3-dihydrobenzimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-difluoroethyl)-1,3-dihydrobenzimidazole-2-thione?
The IUPAC name of 5-(2,2-difluoroethyl)-1,3-dihydrobenzimidazole-2-thione (CID 118554909) is 5-(2,2-difluoroethyl)-1,3-dihydrobenzimidazole-2-thione.
What is the SMILES notation for 5-(2,2-difluoroethyl)-1,3-dihydrobenzimidazole-2-thione?
The canonical SMILES for 5-(2,2-difluoroethyl)-1,3-dihydrobenzimidazole-2-thione is FC(F)Cc1ccc2[nH]c(=S)[nH]c2c1.
What is the InChIKey of 5-(2,2-difluoroethyl)-1,3-dihydrobenzimidazole-2-thione?
The InChIKey is JCHAVQIKSHFZIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2N2S/c10-8(11)4-5-1-2-6-7(3-5)13-9(14)12-6/h1-3,8H,4H2,(H2,12,13,14).
What are the key properties of 5-(2,2-difluoroethyl)-1,3-dihydrobenzimidazole-2-thione?
5-(2,2-difluoroethyl)-1,3-dihydrobenzimidazole-2-thione has a molecular weight of 214.24 g/mol, XLogP of 3.03, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluoroethyl)-1,3-dihydrobenzimidazole-2-thione is sourced from PubChem (CID 118554909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).