C16H11F5N2OS — CID 118554999
2-(3-ethylsulfanyl-2-pyridinyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,3-benzoxazole (PubChem CID 118554999) has the molecular formula C16H11F5N2OS and a molecular weight of 374.33 g/mol. Its IUPAC name is 2-(3-ethylsulfanyl-2-pyridinyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,3-benzoxazole.
| Compound Name | 2-(3-ethylsulfanyl-2-pyridinyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 118554999 |
| Molecular Formula | C16H11F5N2OS |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 2-(3-ethylsulfanyl-2-pyridinyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,3-benzoxazole |
| SMILES | CCSc1cccnc1-c1nc2cc(C(F)(F)C(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C16H11F5N2OS/c1-2-25-12-4-3-7-22-13(12)14-23-10-8-9(5-6-11(10)24-14)15(17,18)16(19,20)21/h3-8H,2H2,1H3 |
| InChIKey | SXPSDMDGOBUFLN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|