C19H18N4O2 — CID 118555430
(4-phenyl-3,6-dihydro-2H-pyridin-1-yl) N-(1H-indazol-3-yl)carbamate (PubChem CID 118555430) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is (4-phenyl-3,6-dihydro-2H-pyridin-1-yl) N-(1H-indazol-3-yl)carbamate.
| Compound Name | (4-phenyl-3,6-dihydro-2H-pyridin-1-yl) N-(1H-indazol-3-yl)carbamate |
|---|---|
| PubChem CID | 118555430 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (4-phenyl-3,6-dihydro-2H-pyridin-1-yl) N-(1H-indazol-3-yl)carbamate |
| SMILES | O=C(Nc1n[nH]c2ccccc12)ON1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H18N4O2/c24-19(20-18-16-8-4-5-9-17(16)21-22-18)25-23-12-10-15(11-13-23)14-6-2-1-3-7-14/h1-10H,11-13H2,(H2,20,21,22,24) |
| InChIKey | ZSYLTKCKQXIWMP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |