About (4-phenyl-3,6-dihydro-2H-pyridin-1-yl) N-(1H-indazol-3-yl)carbamate
(4-phenyl-3,6-dihydro-2H-pyridin-1-yl) N-(1H-indazol-3-yl)carbamate (PubChem CID 118555430) has the molecular formula C19H18N4O2
and a molecular weight of 334.38 g/mol. Its IUPAC name is (4-phenyl-3,6-dihydro-2H-pyridin-1-yl) N-(1H-indazol-3-yl)carbamate.
Molecular Properties
| Compound Name | (4-phenyl-3,6-dihydro-2H-pyridin-1-yl) N-(1H-indazol-3-yl)carbamate |
| PubChem CID | 118555430 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (4-phenyl-3,6-dihydro-2H-pyridin-1-yl) N-(1H-indazol-3-yl)carbamate |
| SMILES | O=C(Nc1n[nH]c2ccccc12)ON1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H18N4O2/c24-19(20-18-16-8-4-5-9-17(16)21-22-18)25-23-12-10-15(11-13-23)14-6-2-1-3-7-14/h1-10H,11-13H2,(H2,20,21,22,24) |
| InChIKey | ZSYLTKCKQXIWMP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-phenyl-3,6-dihydro-2H-pyridin-1-yl) N-(1H-indazol-3-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenyl-3,6-dihydro-2H-pyridin-1-yl) N-(1H-indazol-3-yl)carbamate?
The IUPAC name of (4-phenyl-3,6-dihydro-2H-pyridin-1-yl) N-(1H-indazol-3-yl)carbamate (CID 118555430) is (4-phenyl-3,6-dihydro-2H-pyridin-1-yl) N-(1H-indazol-3-yl)carbamate.
What is the SMILES notation for (4-phenyl-3,6-dihydro-2H-pyridin-1-yl) N-(1H-indazol-3-yl)carbamate?
The canonical SMILES for (4-phenyl-3,6-dihydro-2H-pyridin-1-yl) N-(1H-indazol-3-yl)carbamate is O=C(Nc1n[nH]c2ccccc12)ON1CC=C(c2ccccc2)CC1.
What is the InChIKey of (4-phenyl-3,6-dihydro-2H-pyridin-1-yl) N-(1H-indazol-3-yl)carbamate?
The InChIKey is ZSYLTKCKQXIWMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4O2/c24-19(20-18-16-8-4-5-9-17(16)21-22-18)25-23-12-10-15(11-13-23)14-6-2-1-3-7-14/h1-10H,11-13H2,(H2,20,21,22,24).
What are the key properties of (4-phenyl-3,6-dihydro-2H-pyridin-1-yl) N-(1H-indazol-3-yl)carbamate?
(4-phenyl-3,6-dihydro-2H-pyridin-1-yl) N-(1H-indazol-3-yl)carbamate has a molecular weight of 334.38 g/mol, XLogP of 3.82, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenyl-3,6-dihydro-2H-pyridin-1-yl) N-(1H-indazol-3-yl)carbamate is sourced from PubChem (CID 118555430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).