About 1-tert-butyl-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid
1-tert-butyl-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid (PubChem CID 118555554) has the molecular formula C13H23N3O3
and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-tert-butyl-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid.
Molecular Properties
| Compound Name | 1-tert-butyl-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid |
| PubChem CID | 118555554 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 1-tert-butyl-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid |
| SMILES | CC(C)(C)N1CCNC(=O)C12CCN(C(=O)O)CC2 |
| InChI | InChI=1S/C13H23N3O3/c1-12(2,3)16-9-6-14-10(17)13(16)4-7-15(8-5-13)11(18)19/h4-9H2,1-3H3,(H,14,17)(H,18,19) |
| InChIKey | AWHMCQOQVQTBQL-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-tert-butyl-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid?
The IUPAC name of 1-tert-butyl-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid (CID 118555554) is 1-tert-butyl-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid.
What is the SMILES notation for 1-tert-butyl-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid?
The canonical SMILES for 1-tert-butyl-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid is CC(C)(C)N1CCNC(=O)C12CCN(C(=O)O)CC2.
What is the InChIKey of 1-tert-butyl-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid?
The InChIKey is AWHMCQOQVQTBQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O3/c1-12(2,3)16-9-6-14-10(17)13(16)4-7-15(8-5-13)11(18)19/h4-9H2,1-3H3,(H,14,17)(H,18,19).
What are the key properties of 1-tert-butyl-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid?
1-tert-butyl-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid has a molecular weight of 269.34 g/mol, XLogP of 0.73, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid is sourced from PubChem (CID 118555554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).