C26H22Cl2N4O3 — CID 118555857
(3,5-dichlorophenyl)methyl (3aS,6aR)-2-(9H-pyrido[3,4-b]indole-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 118555857) has the molecular formula C26H22Cl2N4O3 and a molecular weight of 509.39 g/mol. Its IUPAC name is (3,5-dichlorophenyl)methyl (3aS,6aR)-2-(9H-pyrido[3,4-b]indole-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | (3,5-dichlorophenyl)methyl (3aS,6aR)-2-(9H-pyrido[3,4-b]indole-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 118555857 |
| Molecular Formula | C26H22Cl2N4O3 |
| Molecular Weight | 509.39 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | (3,5-dichlorophenyl)methyl (3aS,6aR)-2-(9H-pyrido[3,4-b]indole-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | O=C(OCc1cc(Cl)cc(Cl)c1)N1C[C@@H]2CN(C(=O)c3cc4c(cn3)[nH]c3ccccc34)C[C@@H]2C1 |
| InChI | InChI=1S/C26H22Cl2N4O3/c27-18-5-15(6-19(28)7-18)14-35-26(34)32-12-16-10-31(11-17(16)13-32)25(33)23-8-21-20-3-1-2-4-22(20)30-24(21)9-29-23/h1-9,16-17,30H,10-14H2/t16-,17+ |
| InChIKey | RSEBXUZVZKWAFT-CALCHBBNSA-N |
| XLogP | 5.36 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |