About (1R)-3,3-difluoro-1-hydroxycyclohexane-1-carboxamide
(1R)-3,3-difluoro-1-hydroxycyclohexane-1-carboxamide (PubChem CID 118555977) has the molecular formula C7H11F2NO2
and a molecular weight of 179.17 g/mol. Its IUPAC name is (1R)-3,3-difluoro-1-hydroxycyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | (1R)-3,3-difluoro-1-hydroxycyclohexane-1-carboxamide |
| PubChem CID | 118555977 |
| Molecular Formula | C7H11F2NO2 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | (1R)-3,3-difluoro-1-hydroxycyclohexane-1-carboxamide |
| SMILES | NC(=O)[C@@]1(O)CCCC(F)(F)C1 |
| InChI | InChI=1S/C7H11F2NO2/c8-7(9)3-1-2-6(12,4-7)5(10)11/h12H,1-4H2,(H2,10,11)/t6-/m1/s1 |
| InChIKey | WIDDBWHEIOCNQT-ZCFIWIBFSA-N |
| XLogP | 0.41 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-3,3-difluoro-1-hydroxycyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-3,3-difluoro-1-hydroxycyclohexane-1-carboxamide?
The IUPAC name of (1R)-3,3-difluoro-1-hydroxycyclohexane-1-carboxamide (CID 118555977) is (1R)-3,3-difluoro-1-hydroxycyclohexane-1-carboxamide.
What is the SMILES notation for (1R)-3,3-difluoro-1-hydroxycyclohexane-1-carboxamide?
The canonical SMILES for (1R)-3,3-difluoro-1-hydroxycyclohexane-1-carboxamide is NC(=O)[C@@]1(O)CCCC(F)(F)C1.
What is the InChIKey of (1R)-3,3-difluoro-1-hydroxycyclohexane-1-carboxamide?
The InChIKey is WIDDBWHEIOCNQT-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H11F2NO2/c8-7(9)3-1-2-6(12,4-7)5(10)11/h12H,1-4H2,(H2,10,11)/t6-/m1/s1.
What are the key properties of (1R)-3,3-difluoro-1-hydroxycyclohexane-1-carboxamide?
(1R)-3,3-difluoro-1-hydroxycyclohexane-1-carboxamide has a molecular weight of 179.17 g/mol, XLogP of 0.41, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-3,3-difluoro-1-hydroxycyclohexane-1-carboxamide is sourced from PubChem (CID 118555977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).