About 4-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phenyl]-2H-phthalazin-1-one
4-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phenyl]-2H-phthalazin-1-one (PubChem CID 118556511) has the molecular formula C25H21N3O2
and a molecular weight of 395.46 g/mol. Its IUPAC name is 4-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phenyl]-2H-phthalazin-1-one.
Molecular Properties
| Compound Name | 4-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phenyl]-2H-phthalazin-1-one |
| PubChem CID | 118556511 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 4-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phenyl]-2H-phthalazin-1-one |
| SMILES | O=C(Cc1ccc(-c2n[nH]c(=O)c3ccccc23)cc1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C25H21N3O2/c29-23(28-15-5-7-18-6-1-4-10-22(18)28)16-17-11-13-19(14-12-17)24-20-8-2-3-9-21(20)25(30)27-26-24/h1-4,6,8-14H,5,7,15-16H2,(H,27,30) |
| InChIKey | SLUIREGPPRISKC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phenyl]-2H-phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phenyl]-2H-phthalazin-1-one?
The IUPAC name of 4-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phenyl]-2H-phthalazin-1-one (CID 118556511) is 4-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phenyl]-2H-phthalazin-1-one.
What is the SMILES notation for 4-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phenyl]-2H-phthalazin-1-one?
The canonical SMILES for 4-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phenyl]-2H-phthalazin-1-one is O=C(Cc1ccc(-c2n[nH]c(=O)c3ccccc23)cc1)N1CCCc2ccccc21.
What is the InChIKey of 4-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phenyl]-2H-phthalazin-1-one?
The InChIKey is SLUIREGPPRISKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N3O2/c29-23(28-15-5-7-18-6-1-4-10-22(18)28)16-17-11-13-19(14-12-17)24-20-8-2-3-9-21(20)25(30)27-26-24/h1-4,6,8-14H,5,7,15-16H2,(H,27,30).
What are the key properties of 4-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phenyl]-2H-phthalazin-1-one?
4-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phenyl]-2H-phthalazin-1-one has a molecular weight of 395.46 g/mol, XLogP of 4.11, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]phenyl]-2H-phthalazin-1-one is sourced from PubChem (CID 118556511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).