About 1,2-diaminopropyl phosphono hydrogen phosphate
1,2-diaminopropyl phosphono hydrogen phosphate (PubChem CID 118556685) has the molecular formula C3H12N2O7P2
and a molecular weight of 250.08 g/mol. Its IUPAC name is 1,2-diaminopropyl phosphono hydrogen phosphate.
Molecular Properties
| Compound Name | 1,2-diaminopropyl phosphono hydrogen phosphate |
| PubChem CID | 118556685 |
| Molecular Formula | C3H12N2O7P2 |
| Molecular Weight | 250.08 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 1,2-diaminopropyl phosphono hydrogen phosphate |
| SMILES | CC(N)C(N)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C3H12N2O7P2/c1-2(4)3(5)11-14(9,10)12-13(6,7)8/h2-3H,4-5H2,1H3,(H,9,10)(H2,6,7,8) |
| InChIKey | PFWRSSMGSJRYSV-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 165.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.08 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diaminopropyl phosphono hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diaminopropyl phosphono hydrogen phosphate?
The IUPAC name of 1,2-diaminopropyl phosphono hydrogen phosphate (CID 118556685) is 1,2-diaminopropyl phosphono hydrogen phosphate.
What is the SMILES notation for 1,2-diaminopropyl phosphono hydrogen phosphate?
The canonical SMILES for 1,2-diaminopropyl phosphono hydrogen phosphate is CC(N)C(N)OP(=O)(O)OP(=O)(O)O.
What is the InChIKey of 1,2-diaminopropyl phosphono hydrogen phosphate?
The InChIKey is PFWRSSMGSJRYSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H12N2O7P2/c1-2(4)3(5)11-14(9,10)12-13(6,7)8/h2-3H,4-5H2,1H3,(H,9,10)(H2,6,7,8).
What are the key properties of 1,2-diaminopropyl phosphono hydrogen phosphate?
1,2-diaminopropyl phosphono hydrogen phosphate has a molecular weight of 250.08 g/mol, XLogP of -1.16, 5 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diaminopropyl phosphono hydrogen phosphate is sourced from PubChem (CID 118556685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).