About 2-[4-(2-aminoethyl)piperazin-1-yl]ethanamine;phosphono dihydrogen phosphate
2-[4-(2-aminoethyl)piperazin-1-yl]ethanamine;phosphono dihydrogen phosphate (PubChem CID 118556690) has the molecular formula C8H24N4O7P2
and a molecular weight of 350.25 g/mol. Its IUPAC name is 2-[4-(2-aminoethyl)piperazin-1-yl]ethanamine;phosphono dihydrogen phosphate.
Molecular Properties
| Compound Name | 2-[4-(2-aminoethyl)piperazin-1-yl]ethanamine;phosphono dihydrogen phosphate |
| PubChem CID | 118556690 |
| Molecular Formula | C8H24N4O7P2 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 2-[4-(2-aminoethyl)piperazin-1-yl]ethanamine;phosphono dihydrogen phosphate |
| SMILES | NCCN1CCN(CCN)CC1.O=P(O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C8H20N4.H4O7P2/c9-1-3-11-5-7-12(4-2-10)8-6-11;1-8(2,3)7-9(4,5)6/h1-10H2;(H2,1,2,3)(H2,4,5,6) |
| InChIKey | AUEZNQVRHFTBJB-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 182.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2-aminoethyl)piperazin-1-yl]ethanamine;phosphono dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-aminoethyl)piperazin-1-yl]ethanamine;phosphono dihydrogen phosphate?
The IUPAC name of 2-[4-(2-aminoethyl)piperazin-1-yl]ethanamine;phosphono dihydrogen phosphate (CID 118556690) is 2-[4-(2-aminoethyl)piperazin-1-yl]ethanamine;phosphono dihydrogen phosphate.
What is the SMILES notation for 2-[4-(2-aminoethyl)piperazin-1-yl]ethanamine;phosphono dihydrogen phosphate?
The canonical SMILES for 2-[4-(2-aminoethyl)piperazin-1-yl]ethanamine;phosphono dihydrogen phosphate is NCCN1CCN(CCN)CC1.O=P(O)(O)OP(=O)(O)O.
What is the InChIKey of 2-[4-(2-aminoethyl)piperazin-1-yl]ethanamine;phosphono dihydrogen phosphate?
The InChIKey is AUEZNQVRHFTBJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N4.H4O7P2/c9-1-3-11-5-7-12(4-2-10)8-6-11;1-8(2,3)7-9(4,5)6/h1-10H2;(H2,1,2,3)(H2,4,5,6).
What are the key properties of 2-[4-(2-aminoethyl)piperazin-1-yl]ethanamine;phosphono dihydrogen phosphate?
2-[4-(2-aminoethyl)piperazin-1-yl]ethanamine;phosphono dihydrogen phosphate has a molecular weight of 350.25 g/mol, XLogP of -2.29, 6 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-aminoethyl)piperazin-1-yl]ethanamine;phosphono dihydrogen phosphate is sourced from PubChem (CID 118556690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).